C12H23N3O2 — CID 66259246
1,4-diazepan-1-yl-[4-(ethylamino)oxolan-3-yl]methanone (PubChem CID 66259246) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[4-(ethylamino)oxolan-3-yl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[4-(ethylamino)oxolan-3-yl]methanone |
|---|---|
| PubChem CID | 66259246 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1,4-diazepan-1-yl-[4-(ethylamino)oxolan-3-yl]methanone |
| SMILES | CCNC1COCC1C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C12H23N3O2/c1-2-14-11-9-17-8-10(11)12(16)15-6-3-4-13-5-7-15/h10-11,13-14H,2-9H2,1H3 |
| InChIKey | UADDTZPUYBHYJZ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |