C13H24N2O4 — CID 66259275
methyl 3-[[4-(ethylamino)oxolane-3-carbonyl]-methylamino]-2-methylpropanoate (PubChem CID 66259275) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is methyl 3-[[4-(ethylamino)oxolane-3-carbonyl]-methylamino]-2-methylpropanoate.
| Compound Name | methyl 3-[[4-(ethylamino)oxolane-3-carbonyl]-methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 66259275 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | methyl 3-[[4-(ethylamino)oxolane-3-carbonyl]-methylamino]-2-methylpropanoate |
| SMILES | CCNC1COCC1C(=O)N(C)CC(C)C(=O)OC |
| InChI | InChI=1S/C13H24N2O4/c1-5-14-11-8-19-7-10(11)12(16)15(3)6-9(2)13(17)18-4/h9-11,14H,5-8H2,1-4H3 |
| InChIKey | IPTWGDGTXXYDBV-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |