C20H35N — CID 66259547
2-ethyl-1-[4-(2-methylbutan-2-yl)phenyl]-N-propylbutan-1-amine (PubChem CID 66259547) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is 2-ethyl-1-[4-(2-methylbutan-2-yl)phenyl]-N-propylbutan-1-amine.
| Compound Name | 2-ethyl-1-[4-(2-methylbutan-2-yl)phenyl]-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 66259547 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | 2-ethyl-1-[4-(2-methylbutan-2-yl)phenyl]-N-propylbutan-1-amine |
| SMILES | CCCNC(c1ccc(C(C)(C)CC)cc1)C(CC)CC |
| InChI | InChI=1S/C20H35N/c1-7-15-21-19(16(8-2)9-3)17-11-13-18(14-12-17)20(5,6)10-4/h11-14,16,19,21H,7-10,15H2,1-6H3 |
| InChIKey | PKSJCVHZFPYLRG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |