About 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide
4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide (PubChem CID 66260004) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide.
Molecular Properties
| Compound Name | 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide |
| PubChem CID | 66260004 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1COCC1NCC |
| InChI | InChI=1S/C13H22N2O2/c1-4-7-15(8-5-2)13(16)11-9-17-10-12(11)14-6-3/h4-5,11-12,14H,1-2,6-10H2,3H3 |
| InChIKey | PGINYHFMGBRZAG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide?
The IUPAC name of 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide (CID 66260004) is 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide.
What is the SMILES notation for 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide?
The canonical SMILES for 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide is C=CCN(CC=C)C(=O)C1COCC1NCC.
What is the InChIKey of 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide?
The InChIKey is PGINYHFMGBRZAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-4-7-15(8-5-2)13(16)11-9-17-10-12(11)14-6-3/h4-5,11-12,14H,1-2,6-10H2,3H3.
What are the key properties of 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide?
4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide has a molecular weight of 238.33 g/mol, XLogP of 0.81, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-N,N-bis(prop-2-enyl)oxolane-3-carboxamide is sourced from PubChem (CID 66260004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).