About N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide
N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide (PubChem CID 662625) has the molecular formula C16H15N5O
and a molecular weight of 293.33 g/mol. Its IUPAC name is N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide |
| PubChem CID | 662625 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide |
| SMILES | Cn1nnc(NC(=O)C(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C16H15N5O/c1-21-19-16(18-20-21)17-15(22)14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14H,1H3,(H,17,19,22) |
| InChIKey | PGUUWGJUCVQTIP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide?
The IUPAC name of N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide (CID 662625) is N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide.
What is the SMILES notation for N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide?
The canonical SMILES for N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide is Cn1nnc(NC(=O)C(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide?
The InChIKey is PGUUWGJUCVQTIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O/c1-21-19-16(18-20-21)17-15(22)14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14H,1H3,(H,17,19,22).
What are the key properties of N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide?
N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide has a molecular weight of 293.33 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methyltetrazol-5-yl)-2,2-diphenylacetamide is sourced from PubChem (CID 662625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).