About (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol
(1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol (PubChem CID 66264286) has the molecular formula C11H14N2O3
and a molecular weight of 222.24 g/mol. Its IUPAC name is (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol.
Molecular Properties
| Compound Name | (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol |
| PubChem CID | 66264286 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol |
| SMILES | COc1cc2nc([C@H](C)O)[nH]c2cc1OC |
| InChI | InChI=1S/C11H14N2O3/c1-6(14)11-12-7-4-9(15-2)10(16-3)5-8(7)13-11/h4-6,14H,1-3H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | JNIPHABAQAULLF-LURJTMIESA-N |
| XLogP | 1.63 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol?
The IUPAC name of (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol (CID 66264286) is (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol.
What is the SMILES notation for (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol?
The canonical SMILES for (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol is COc1cc2nc([C@H](C)O)[nH]c2cc1OC.
What is the InChIKey of (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol?
The InChIKey is JNIPHABAQAULLF-LURJTMIESA-N. The full InChI is InChI=1S/C11H14N2O3/c1-6(14)11-12-7-4-9(15-2)10(16-3)5-8(7)13-11/h4-6,14H,1-3H3,(H,12,13)/t6-/m0/s1.
What are the key properties of (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol?
(1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol has a molecular weight of 222.24 g/mol, XLogP of 1.63, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)ethanol is sourced from PubChem (CID 66264286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).