C17H14ClN5S — CID 662661
4-[3-(2-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-N,N-dimethylaniline (PubChem CID 662661) has the molecular formula C17H14ClN5S and a molecular weight of 355.85 g/mol. Its IUPAC name is 4-[3-(2-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-N,N-dimethylaniline.
| Compound Name | 4-[3-(2-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 662661 |
| Molecular Formula | C17H14ClN5S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 4-[3-(2-chlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nn3c(-c4ccccc4Cl)nnc3s2)cc1 |
| InChI | InChI=1S/C17H14ClN5S/c1-22(2)12-9-7-11(8-10-12)16-21-23-15(19-20-17(23)24-16)13-5-3-4-6-14(13)18/h3-10H,1-2H3 |
| InChIKey | IFEOXWGWFOMQDM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |