About 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one
5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one (PubChem CID 662665) has the molecular formula C15H11BrO3
and a molecular weight of 319.15 g/mol. Its IUPAC name is 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one.
Molecular Properties
| Compound Name | 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one |
| PubChem CID | 662665 |
| Molecular Formula | C15H11BrO3 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one |
| SMILES | O=C(c1ccc(Br)cc1)C1CCc2occc2C1=O |
| InChI | InChI=1S/C15H11BrO3/c16-10-3-1-9(2-4-10)14(17)12-5-6-13-11(15(12)18)7-8-19-13/h1-4,7-8,12H,5-6H2 |
| InChIKey | OSGNVDXVAYENHQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one?
The IUPAC name of 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one (CID 662665) is 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one.
What is the SMILES notation for 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one?
The canonical SMILES for 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one is O=C(c1ccc(Br)cc1)C1CCc2occc2C1=O.
What is the InChIKey of 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one?
The InChIKey is OSGNVDXVAYENHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrO3/c16-10-3-1-9(2-4-10)14(17)12-5-6-13-11(15(12)18)7-8-19-13/h1-4,7-8,12H,5-6H2.
What are the key properties of 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one?
5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one has a molecular weight of 319.15 g/mol, XLogP of 3.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromobenzoyl)-6,7-dihydro-5H-1-benzofuran-4-one is sourced from PubChem (CID 662665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).