C10H20N2O4 — CID 66266669
N-(2-hydroxy-3-methoxypropyl)-4-(methylamino)oxolane-3-carboxamide (PubChem CID 66266669) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is N-(2-hydroxy-3-methoxypropyl)-4-(methylamino)oxolane-3-carboxamide.
| Compound Name | N-(2-hydroxy-3-methoxypropyl)-4-(methylamino)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 66266669 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | N-(2-hydroxy-3-methoxypropyl)-4-(methylamino)oxolane-3-carboxamide |
| SMILES | CNC1COCC1C(=O)NCC(O)COC |
| InChI | InChI=1S/C10H20N2O4/c1-11-9-6-16-5-8(9)10(14)12-3-7(13)4-15-2/h7-9,11,13H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | ZMMPUBRNTHPFRZ-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |