About 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol
2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol (PubChem CID 66268867) has the molecular formula C14H15N5O2
and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol |
| PubChem CID | 66268867 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNc2ccc(-c3cnco3)cc2)nn1 |
| InChI | InChI=1S/C14H15N5O2/c20-6-5-19-9-13(17-18-19)7-16-12-3-1-11(2-4-12)14-8-15-10-21-14/h1-4,8-10,16,20H,5-7H2 |
| InChIKey | LTGHAXCWKVZTAS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol?
The IUPAC name of 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol (CID 66268867) is 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol.
What is the SMILES notation for 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol?
The canonical SMILES for 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol is OCCn1cc(CNc2ccc(-c3cnco3)cc2)nn1.
What is the InChIKey of 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol?
The InChIKey is LTGHAXCWKVZTAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5O2/c20-6-5-19-9-13(17-18-19)7-16-12-3-1-11(2-4-12)14-8-15-10-21-14/h1-4,8-10,16,20H,5-7H2.
What are the key properties of 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol?
2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol has a molecular weight of 285.31 g/mol, XLogP of 1.54, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[4-(1,3-oxazol-5-yl)anilino]methyl]triazol-1-yl]ethanol is sourced from PubChem (CID 66268867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).