About 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol
2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol (PubChem CID 66269075) has the molecular formula C10H17N7O
and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol |
| PubChem CID | 66269075 |
| Molecular Formula | C10H17N7O |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol |
| SMILES | Cn1cnnc1CCNCc1cn(CCO)nn1 |
| InChI | InChI=1S/C10H17N7O/c1-16-8-12-14-10(16)2-3-11-6-9-7-17(4-5-18)15-13-9/h7-8,11,18H,2-6H2,1H3 |
| InChIKey | BZJQRFWQNFXLQR-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol?
The IUPAC name of 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol (CID 66269075) is 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol.
What is the SMILES notation for 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol?
The canonical SMILES for 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol is Cn1cnnc1CCNCc1cn(CCO)nn1.
What is the InChIKey of 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol?
The InChIKey is BZJQRFWQNFXLQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N7O/c1-16-8-12-14-10(16)2-3-11-6-9-7-17(4-5-18)15-13-9/h7-8,11,18H,2-6H2,1H3.
What are the key properties of 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol?
2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol has a molecular weight of 251.29 g/mol, XLogP of -1.27, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]triazol-1-yl]ethanol is sourced from PubChem (CID 66269075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).