About 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine
2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine (PubChem CID 66269197) has the molecular formula C12H26N2O2S
and a molecular weight of 262.42 g/mol. Its IUPAC name is 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine.
Molecular Properties
| Compound Name | 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine |
| PubChem CID | 66269197 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine |
| SMILES | COC(CC(CN)N1CC(C)SC(C)C1)OC |
| InChI | InChI=1S/C12H26N2O2S/c1-9-7-14(8-10(2)17-9)11(6-13)5-12(15-3)16-4/h9-12H,5-8,13H2,1-4H3 |
| InChIKey | VXLWCBGZEOMQFS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine?
The IUPAC name of 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine (CID 66269197) is 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine.
What is the SMILES notation for 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine?
The canonical SMILES for 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine is COC(CC(CN)N1CC(C)SC(C)C1)OC.
What is the InChIKey of 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine?
The InChIKey is VXLWCBGZEOMQFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O2S/c1-9-7-14(8-10(2)17-9)11(6-13)5-12(15-3)16-4/h9-12H,5-8,13H2,1-4H3.
What are the key properties of 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine?
2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine has a molecular weight of 262.42 g/mol, XLogP of 1.15, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylthiomorpholin-4-yl)-4,4-dimethoxybutan-1-amine is sourced from PubChem (CID 66269197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).