About 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile
2-(cyclohexylamino)-4,4-dimethoxybutanenitrile (PubChem CID 66269206) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile.
Molecular Properties
| Compound Name | 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile |
| PubChem CID | 66269206 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile |
| SMILES | COC(CC(C#N)NC1CCCCC1)OC |
| InChI | InChI=1S/C12H22N2O2/c1-15-12(16-2)8-11(9-13)14-10-6-4-3-5-7-10/h10-12,14H,3-8H2,1-2H3 |
| InChIKey | YUCFAIGNHGXXDS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile?
The IUPAC name of 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile (CID 66269206) is 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile.
What is the SMILES notation for 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile?
The canonical SMILES for 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile is COC(CC(C#N)NC1CCCCC1)OC.
What is the InChIKey of 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile?
The InChIKey is YUCFAIGNHGXXDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-15-12(16-2)8-11(9-13)14-10-6-4-3-5-7-10/h10-12,14H,3-8H2,1-2H3.
What are the key properties of 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile?
2-(cyclohexylamino)-4,4-dimethoxybutanenitrile has a molecular weight of 226.32 g/mol, XLogP of 1.81, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylamino)-4,4-dimethoxybutanenitrile is sourced from PubChem (CID 66269206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).