C13H17N5O3 — CID 66269651
2-[1-(2-hydroxyethyl)triazol-4-yl]-2-(2-methoxyanilino)acetamide (PubChem CID 66269651) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[1-(2-hydroxyethyl)triazol-4-yl]-2-(2-methoxyanilino)acetamide.
| Compound Name | 2-[1-(2-hydroxyethyl)triazol-4-yl]-2-(2-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 66269651 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[1-(2-hydroxyethyl)triazol-4-yl]-2-(2-methoxyanilino)acetamide |
| SMILES | COc1ccccc1NC(C(N)=O)c1cn(CCO)nn1 |
| InChI | InChI=1S/C13H17N5O3/c1-21-11-5-3-2-4-9(11)15-12(13(14)20)10-8-18(6-7-19)17-16-10/h2-5,8,12,15,19H,6-7H2,1H3,(H2,14,20) |
| InChIKey | SYSYACGLIDYYCI-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |