C13H24N6O2 — CID 66269796
2-[4-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]piperidin-1-yl]-N-methylacetamide (PubChem CID 66269796) has the molecular formula C13H24N6O2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-[4-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 66269796 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[4-[[1-(2-hydroxyethyl)triazol-4-yl]methylamino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(NCc2cn(CCO)nn2)CC1 |
| InChI | InChI=1S/C13H24N6O2/c1-14-13(21)10-18-4-2-11(3-5-18)15-8-12-9-19(6-7-20)17-16-12/h9,11,15,20H,2-8,10H2,1H3,(H,14,21) |
| InChIKey | WKHHLWLGOKQPHM-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 95.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |