C13H18N2O2 — CID 66269954
4,4-dimethoxy-2-(2-methylanilino)butanenitrile (PubChem CID 66269954) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4,4-dimethoxy-2-(2-methylanilino)butanenitrile.
| Compound Name | 4,4-dimethoxy-2-(2-methylanilino)butanenitrile |
|---|---|
| PubChem CID | 66269954 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 4,4-dimethoxy-2-(2-methylanilino)butanenitrile |
| SMILES | COC(CC(C#N)Nc1ccccc1C)OC |
| InChI | InChI=1S/C13H18N2O2/c1-10-6-4-5-7-12(10)15-11(9-14)8-13(16-2)17-3/h4-7,11,13,15H,8H2,1-3H3 |
| InChIKey | APHHBIDIZICOIB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|