C9H15F3N4O2 — CID 66270018
2-[4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]triazol-1-yl]ethanol (PubChem CID 66270018) has the molecular formula C9H15F3N4O2 and a molecular weight of 268.24 g/mol. Its IUPAC name is 2-[4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66270018 |
| Molecular Formula | C9H15F3N4O2 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-[4-[[2-(2,2,2-trifluoroethoxy)ethylamino]methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNCCOCC(F)(F)F)nn1 |
| InChI | InChI=1S/C9H15F3N4O2/c10-9(11,12)7-18-4-1-13-5-8-6-16(2-3-17)15-14-8/h6,13,17H,1-5,7H2 |
| InChIKey | DNSYALDYOLSWJH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|