C15H31N3O2 — CID 66270520
4,4-dimethoxy-2-(3-piperidin-1-ylpyrrolidin-1-yl)butan-1-amine (PubChem CID 66270520) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is 4,4-dimethoxy-2-(3-piperidin-1-ylpyrrolidin-1-yl)butan-1-amine.
| Compound Name | 4,4-dimethoxy-2-(3-piperidin-1-ylpyrrolidin-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 66270520 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | 4,4-dimethoxy-2-(3-piperidin-1-ylpyrrolidin-1-yl)butan-1-amine |
| SMILES | COC(CC(CN)N1CCC(N2CCCCC2)C1)OC |
| InChI | InChI=1S/C15H31N3O2/c1-19-15(20-2)10-14(11-16)18-9-6-13(12-18)17-7-4-3-5-8-17/h13-15H,3-12,16H2,1-2H3 |
| InChIKey | DLJJBYXUGCEKFO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|