About 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile
2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile (PubChem CID 66270526) has the molecular formula C12H25N3O2
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile.
Molecular Properties
| Compound Name | 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile |
| PubChem CID | 66270526 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile |
| SMILES | CCN(CC)CCNC(C#N)CC(OC)OC |
| InChI | InChI=1S/C12H25N3O2/c1-5-15(6-2)8-7-14-11(10-13)9-12(16-3)17-4/h11-12,14H,5-9H2,1-4H3 |
| InChIKey | OTSFFYNGXZMRFY-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile?
The IUPAC name of 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile (CID 66270526) is 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile.
What is the SMILES notation for 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile?
The canonical SMILES for 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile is CCN(CC)CCNC(C#N)CC(OC)OC.
What is the InChIKey of 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile?
The InChIKey is OTSFFYNGXZMRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O2/c1-5-15(6-2)8-7-14-11(10-13)9-12(16-3)17-4/h11-12,14H,5-9H2,1-4H3.
What are the key properties of 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile?
2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile has a molecular weight of 243.35 g/mol, XLogP of 0.82, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diethylamino)ethylamino]-4,4-dimethoxybutanenitrile is sourced from PubChem (CID 66270526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).