C11H16N4OS — CID 66270863
3-[4-[(thiophen-3-ylmethylamino)methyl]triazol-1-yl]propan-1-ol (PubChem CID 66270863) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-[4-[(thiophen-3-ylmethylamino)methyl]triazol-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(thiophen-3-ylmethylamino)methyl]triazol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 66270863 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-[4-[(thiophen-3-ylmethylamino)methyl]triazol-1-yl]propan-1-ol |
| SMILES | OCCCn1cc(CNCc2ccsc2)nn1 |
| InChI | InChI=1S/C11H16N4OS/c16-4-1-3-15-8-11(13-14-15)7-12-6-10-2-5-17-9-10/h2,5,8-9,12,16H,1,3-4,6-7H2 |
| InChIKey | YTAWDRCGRDHKBP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |