C12H17FN2O3 — CID 66270904
2-(4-fluoroanilino)-4,4-dimethoxybutanamide (PubChem CID 66270904) has the molecular formula C12H17FN2O3 and a molecular weight of 256.28 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-4,4-dimethoxybutanamide.
| Compound Name | 2-(4-fluoroanilino)-4,4-dimethoxybutanamide |
|---|---|
| PubChem CID | 66270904 |
| Molecular Formula | C12H17FN2O3 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-(4-fluoroanilino)-4,4-dimethoxybutanamide |
| SMILES | COC(CC(Nc1ccc(F)cc1)C(N)=O)OC |
| InChI | InChI=1S/C12H17FN2O3/c1-17-11(18-2)7-10(12(14)16)15-9-5-3-8(13)4-6-9/h3-6,10-11,15H,7H2,1-2H3,(H2,14,16) |
| InChIKey | GYNCHBSWAWAWPO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|