About 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine
4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine (PubChem CID 66271308) has the molecular formula C11H19F3N2
and a molecular weight of 236.28 g/mol. Its IUPAC name is 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine.
Molecular Properties
| Compound Name | 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine |
| PubChem CID | 66271308 |
| Molecular Formula | C11H19F3N2 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine |
| SMILES | FC(F)(F)CN1CCCC1C1CCNCC1 |
| InChI | InChI=1S/C11H19F3N2/c12-11(13,14)8-16-7-1-2-10(16)9-3-5-15-6-4-9/h9-10,15H,1-8H2 |
| InChIKey | CCBBCORVUGWHFE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine?
The IUPAC name of 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine (CID 66271308) is 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine.
What is the SMILES notation for 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine?
The canonical SMILES for 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine is FC(F)(F)CN1CCCC1C1CCNCC1.
What is the InChIKey of 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine?
The InChIKey is CCBBCORVUGWHFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N2/c12-11(13,14)8-16-7-1-2-10(16)9-3-5-15-6-4-9/h9-10,15H,1-8H2.
What are the key properties of 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine?
4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine has a molecular weight of 236.28 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]piperidine is sourced from PubChem (CID 66271308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).