C9H11ClN4O — CID 66272393
2-(3-chloro-2-methylpropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66272393) has the molecular formula C9H11ClN4O and a molecular weight of 226.67 g/mol. Its IUPAC name is 2-(3-chloro-2-methylpropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-(3-chloro-2-methylpropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66272393 |
| Molecular Formula | C9H11ClN4O |
| Molecular Weight | 226.67 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-(3-chloro-2-methylpropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | CC(CCl)Cn1nc2cnccn2c1=O |
| InChI | InChI=1S/C9H11ClN4O/c1-7(4-10)6-14-9(15)13-3-2-11-5-8(13)12-14/h2-3,5,7H,4,6H2,1H3 |
| InChIKey | CJMKVCRIPKIRAD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.67 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|