C8H9N7O — CID 66272409
2-(3-azidopropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66272409) has the molecular formula C8H9N7O and a molecular weight of 219.21 g/mol. Its IUPAC name is 2-(3-azidopropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-(3-azidopropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66272409 |
| Molecular Formula | C8H9N7O |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-(3-azidopropyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | [N-]=[N+]=NCCCn1nc2cnccn2c1=O |
| InChI | InChI=1S/C8H9N7O/c9-13-11-2-1-4-15-8(16)14-5-3-10-6-7(14)12-15/h3,5-6H,1-2,4H2 |
| InChIKey | RINISPVTYSWRBR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 100.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|