C10H13ClN4O — CID 66272818
2-(5-chloropentyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66272818) has the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. Its IUPAC name is 2-(5-chloropentyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-(5-chloropentyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66272818 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-(5-chloropentyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | O=c1n(CCCCCCl)nc2cnccn12 |
| InChI | InChI=1S/C10H13ClN4O/c11-4-2-1-3-6-15-10(16)14-7-5-12-8-9(14)13-15/h5,7-8H,1-4,6H2 |
| InChIKey | YNBNUBGYYJRNTQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|