C14H19BrN4O — CID 66273035
2-[[1-(bromomethyl)cycloheptyl]methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66273035) has the molecular formula C14H19BrN4O and a molecular weight of 339.24 g/mol. Its IUPAC name is 2-[[1-(bromomethyl)cycloheptyl]methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-[[1-(bromomethyl)cycloheptyl]methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66273035 |
| Molecular Formula | C14H19BrN4O |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-[[1-(bromomethyl)cycloheptyl]methyl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | O=c1n(CC2(CBr)CCCCCC2)nc2cnccn12 |
| InChI | InChI=1S/C14H19BrN4O/c15-10-14(5-3-1-2-4-6-14)11-19-13(20)18-8-7-16-9-12(18)17-19/h7-9H,1-6,10-11H2 |
| InChIKey | JNTICYULJFAUGP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|