C15H21NO — CID 66273110
(4,4-dimethylcyclohexyl)-(4-methyl-3-pyridinyl)methanone (PubChem CID 66273110) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl)-(4-methyl-3-pyridinyl)methanone.
| Compound Name | (4,4-dimethylcyclohexyl)-(4-methyl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 66273110 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (4,4-dimethylcyclohexyl)-(4-methyl-3-pyridinyl)methanone |
| SMILES | Cc1ccncc1C(=O)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H21NO/c1-11-6-9-16-10-13(11)14(17)12-4-7-15(2,3)8-5-12/h6,9-10,12H,4-5,7-8H2,1-3H3 |
| InChIKey | ZPQOJUCLHWTHHC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |