C11H15ClN4O — CID 66273463
2-(6-chlorohexyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 66273463) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is 2-(6-chlorohexyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-(6-chlorohexyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 66273463 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-(6-chlorohexyl)-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | O=c1n(CCCCCCCl)nc2cnccn12 |
| InChI | InChI=1S/C11H15ClN4O/c12-5-3-1-2-4-7-16-11(17)15-8-6-13-9-10(15)14-16/h6,8-9H,1-5,7H2 |
| InChIKey | WCSIWRAYLHDOKO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|