About [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine
[3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine (PubChem CID 66274453) has the molecular formula C13H14F3NOS
and a molecular weight of 289.32 g/mol. Its IUPAC name is [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine.
Molecular Properties
| Compound Name | [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine |
| PubChem CID | 66274453 |
| Molecular Formula | C13H14F3NOS |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine |
| SMILES | CC(OCc1c(CN)sc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NOS/c1-8(13(14,15)16)18-7-10-9-4-2-3-5-11(9)19-12(10)6-17/h2-5,8H,6-7,17H2,1H3 |
| InChIKey | BZGJXJZWTRKNCQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine?
The IUPAC name of [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine (CID 66274453) is [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine.
What is the SMILES notation for [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine?
The canonical SMILES for [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine is CC(OCc1c(CN)sc2ccccc12)C(F)(F)F.
What is the InChIKey of [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine?
The InChIKey is BZGJXJZWTRKNCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3NOS/c1-8(13(14,15)16)18-7-10-9-4-2-3-5-11(9)19-12(10)6-17/h2-5,8H,6-7,17H2,1H3.
What are the key properties of [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine?
[3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine has a molecular weight of 289.32 g/mol, XLogP of 3.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(1,1,1-trifluoropropan-2-yloxymethyl)-1-benzothiophen-2-yl]methanamine is sourced from PubChem (CID 66274453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).