About 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide
3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide (PubChem CID 66274598) has the molecular formula C6H11F3N2O
and a molecular weight of 184.16 g/mol. Its IUPAC name is 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide.
Molecular Properties
| Compound Name | 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide |
| PubChem CID | 66274598 |
| Molecular Formula | C6H11F3N2O |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide |
| SMILES | [H]/N=C(\N)CCOC(C)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O/c1-4(6(7,8)9)12-3-2-5(10)11/h4H,2-3H2,1H3,(H3,10,11) |
| InChIKey | OZWRVVSOALWLKO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide?
The IUPAC name of 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide (CID 66274598) is 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide.
What is the SMILES notation for 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide?
The canonical SMILES for 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide is [H]/N=C(\N)CCOC(C)C(F)(F)F.
What is the InChIKey of 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide?
The InChIKey is OZWRVVSOALWLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F3N2O/c1-4(6(7,8)9)12-3-2-5(10)11/h4H,2-3H2,1H3,(H3,10,11).
What are the key properties of 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide?
3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide has a molecular weight of 184.16 g/mol, XLogP of 1.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1,1-trifluoropropan-2-yloxy)propanimidamide is sourced from PubChem (CID 66274598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).