C10H19F3N2O — CID 66274816
2,2-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanimidamide (PubChem CID 66274816) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is 2,2-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanimidamide.
| Compound Name | 2,2-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanimidamide |
|---|---|
| PubChem CID | 66274816 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2,2-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pentanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCCOC(C)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O/c1-7(10(11,12)13)16-6-4-5-9(2,3)8(14)15/h7H,4-6H2,1-3H3,(H3,14,15) |
| InChIKey | MOCNPKCAOAATKQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|