C14H20F3NO2 — CID 66274881
N-[[2-[2-(1,1,1-trifluoropropan-2-yloxy)ethoxy]phenyl]methyl]ethanamine (PubChem CID 66274881) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[[2-[2-(1,1,1-trifluoropropan-2-yloxy)ethoxy]phenyl]methyl]ethanamine.
| Compound Name | N-[[2-[2-(1,1,1-trifluoropropan-2-yloxy)ethoxy]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 66274881 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[[2-[2-(1,1,1-trifluoropropan-2-yloxy)ethoxy]phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccccc1OCCOC(C)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO2/c1-3-18-10-12-6-4-5-7-13(12)20-9-8-19-11(2)14(15,16)17/h4-7,11,18H,3,8-10H2,1-2H3 |
| InChIKey | JKVSIUWSCRHANV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|