About 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide
3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide (PubChem CID 66274898) has the molecular formula C9H18F3NO3S
and a molecular weight of 277.31 g/mol. Its IUPAC name is 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide |
| PubChem CID | 66274898 |
| Molecular Formula | C9H18F3NO3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide |
| SMILES | CC(C)C(COC(C)C(F)(F)F)CS(N)(=O)=O |
| InChI | InChI=1S/C9H18F3NO3S/c1-6(2)8(5-17(13,14)15)4-16-7(3)9(10,11)12/h6-8H,4-5H2,1-3H3,(H2,13,14,15) |
| InChIKey | ZZYXSHJIPPISGB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide?
The IUPAC name of 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide (CID 66274898) is 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide.
What is the SMILES notation for 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide?
The canonical SMILES for 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide is CC(C)C(COC(C)C(F)(F)F)CS(N)(=O)=O.
What is the InChIKey of 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide?
The InChIKey is ZZYXSHJIPPISGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO3S/c1-6(2)8(5-17(13,14)15)4-16-7(3)9(10,11)12/h6-8H,4-5H2,1-3H3,(H2,13,14,15).
What are the key properties of 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide?
3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide has a molecular weight of 277.31 g/mol, XLogP of 1.51, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(1,1,1-trifluoropropan-2-yloxymethyl)butane-1-sulfonamide is sourced from PubChem (CID 66274898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).