C12H20N6O — CID 66274906
5-methyl-7-[methyl-[2-(propylamino)ethyl]amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 66274906) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-methyl-7-[methyl-[2-(propylamino)ethyl]amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 5-methyl-7-[methyl-[2-(propylamino)ethyl]amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 66274906 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5-methyl-7-[methyl-[2-(propylamino)ethyl]amino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | CCCNCCN(C)c1cc2n[nH]c(=O)n2c(C)n1 |
| InChI | InChI=1S/C12H20N6O/c1-4-5-13-6-7-17(3)10-8-11-15-16-12(19)18(11)9(2)14-10/h8,13H,4-7H2,1-3H3,(H,16,19) |
| InChIKey | HUFMETVGPIWERA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|