C11H14ClN5O — CID 66274915
7-[2-chloroethyl(cyclopropyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 66274915) has the molecular formula C11H14ClN5O and a molecular weight of 267.72 g/mol. Its IUPAC name is 7-[2-chloroethyl(cyclopropyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-[2-chloroethyl(cyclopropyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 66274915 |
| Molecular Formula | C11H14ClN5O |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 7-[2-chloroethyl(cyclopropyl)amino]-5-methyl-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | Cc1nc(N(CCCl)C2CC2)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C11H14ClN5O/c1-7-13-9(16(5-4-12)8-2-3-8)6-10-14-15-11(18)17(7)10/h6,8H,2-5H2,1H3,(H,15,18) |
| InChIKey | ZRKFJJHSUBGBAO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|