About N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine
N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine (PubChem CID 66275082) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine |
| PubChem CID | 66275082 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine |
| SMILES | CNCC1(OC(C)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C11H20F3NO/c1-9(11(12,13)14)16-10(8-15-2)6-4-3-5-7-10/h9,15H,3-8H2,1-2H3 |
| InChIKey | XVISOHOCXJNUCH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine?
The IUPAC name of N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine (CID 66275082) is N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine.
What is the SMILES notation for N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine?
The canonical SMILES for N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine is CNCC1(OC(C)C(F)(F)F)CCCCC1.
What is the InChIKey of N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine?
The InChIKey is XVISOHOCXJNUCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO/c1-9(11(12,13)14)16-10(8-15-2)6-4-3-5-7-10/h9,15H,3-8H2,1-2H3.
What are the key properties of N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine?
N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine has a molecular weight of 239.28 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[1-(1,1,1-trifluoropropan-2-yloxy)cyclohexyl]methanamine is sourced from PubChem (CID 66275082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).