C12H17F3N2O — CID 66275313
N-[[6-(1,1,1-trifluoropropan-2-yloxy)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 66275313) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is N-[[6-(1,1,1-trifluoropropan-2-yloxy)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-(1,1,1-trifluoropropan-2-yloxy)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66275313 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[[6-(1,1,1-trifluoropropan-2-yloxy)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(OC(C)C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H17F3N2O/c1-3-6-16-7-10-4-5-11(17-8-10)18-9(2)12(13,14)15/h4-5,8-9,16H,3,6-7H2,1-2H3 |
| InChIKey | LSPOPSPQEGVXNR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|