About 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane
1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane (PubChem CID 66275449) has the molecular formula C9H14BrF3O
and a molecular weight of 275.11 g/mol. Its IUPAC name is 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane.
Molecular Properties
| Compound Name | 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane |
| PubChem CID | 66275449 |
| Molecular Formula | C9H14BrF3O |
| Molecular Weight | 275.11 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane |
| SMILES | CC(OCC1(CBr)CCC1)C(F)(F)F |
| InChI | InChI=1S/C9H14BrF3O/c1-7(9(11,12)13)14-6-8(5-10)3-2-4-8/h7H,2-6H2,1H3 |
| InChIKey | CUXVEJDPJGMZIZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.11 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane?
The IUPAC name of 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane (CID 66275449) is 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane.
What is the SMILES notation for 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane?
The canonical SMILES for 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane is CC(OCC1(CBr)CCC1)C(F)(F)F.
What is the InChIKey of 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane?
The InChIKey is CUXVEJDPJGMZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrF3O/c1-7(9(11,12)13)14-6-8(5-10)3-2-4-8/h7H,2-6H2,1H3.
What are the key properties of 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane?
1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane has a molecular weight of 275.11 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclobutane is sourced from PubChem (CID 66275449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).