C11H13ClF3NO — CID 66275486
3-(chloromethyl)-4,6-dimethyl-2-(1,1,1-trifluoropropan-2-yloxy)pyridine (PubChem CID 66275486) has the molecular formula C11H13ClF3NO and a molecular weight of 267.68 g/mol. Its IUPAC name is 3-(chloromethyl)-4,6-dimethyl-2-(1,1,1-trifluoropropan-2-yloxy)pyridine.
| Compound Name | 3-(chloromethyl)-4,6-dimethyl-2-(1,1,1-trifluoropropan-2-yloxy)pyridine |
|---|---|
| PubChem CID | 66275486 |
| Molecular Formula | C11H13ClF3NO |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-(chloromethyl)-4,6-dimethyl-2-(1,1,1-trifluoropropan-2-yloxy)pyridine |
| SMILES | Cc1cc(C)c(CCl)c(OC(C)C(F)(F)F)n1 |
| InChI | InChI=1S/C11H13ClF3NO/c1-6-4-7(2)16-10(9(6)5-12)17-8(3)11(13,14)15/h4,8H,5H2,1-3H3 |
| InChIKey | VHTAVRPEUHYJRK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|