About 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine
3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine (PubChem CID 66276003) has the molecular formula C6H11N5
and a molecular weight of 153.19 g/mol. Its IUPAC name is 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine.
Molecular Properties
| Compound Name | 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine |
| PubChem CID | 66276003 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine |
| SMILES | Nc1nc(N2CCCC2)n[nH]1 |
| InChI | InChI=1S/C6H11N5/c7-5-8-6(10-9-5)11-3-1-2-4-11/h1-4H2,(H3,7,8,9,10) |
| InChIKey | KAMUXTGRBIHCDT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine?
The IUPAC name of 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine (CID 66276003) is 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine.
What is the SMILES notation for 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine?
The canonical SMILES for 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine is Nc1nc(N2CCCC2)n[nH]1.
What is the InChIKey of 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine?
The InChIKey is KAMUXTGRBIHCDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5/c7-5-8-6(10-9-5)11-3-1-2-4-11/h1-4H2,(H3,7,8,9,10).
What are the key properties of 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine?
3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine has a molecular weight of 153.19 g/mol, XLogP of -0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrrolidin-1-yl-1H-1,2,4-triazol-5-amine is sourced from PubChem (CID 66276003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).