About 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol
3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol (PubChem CID 66276308) has the molecular formula C10H20F3NO2
and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol.
Molecular Properties
| Compound Name | 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol |
| PubChem CID | 66276308 |
| Molecular Formula | C10H20F3NO2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol |
| SMILES | CCCNC(CCO)COC(C)C(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2/c1-3-5-14-9(4-6-15)7-16-8(2)10(11,12)13/h8-9,14-15H,3-7H2,1-2H3 |
| InChIKey | YNDMBEAJOXNMJM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol?
The IUPAC name of 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol (CID 66276308) is 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol.
What is the SMILES notation for 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol?
The canonical SMILES for 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol is CCCNC(CCO)COC(C)C(F)(F)F.
What is the InChIKey of 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol?
The InChIKey is YNDMBEAJOXNMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NO2/c1-3-5-14-9(4-6-15)7-16-8(2)10(11,12)13/h8-9,14-15H,3-7H2,1-2H3.
What are the key properties of 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol?
3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol has a molecular weight of 243.27 g/mol, XLogP of 1.70, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butan-1-ol is sourced from PubChem (CID 66276308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).