C11H21N5 — CID 66276682
3-(4,4-diethylpiperidin-1-yl)-1H-1,2,4-triazol-5-amine (PubChem CID 66276682) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-(4,4-diethylpiperidin-1-yl)-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-(4,4-diethylpiperidin-1-yl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 66276682 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 3-(4,4-diethylpiperidin-1-yl)-1H-1,2,4-triazol-5-amine |
| SMILES | CCC1(CC)CCN(c2n[nH]c(N)n2)CC1 |
| InChI | InChI=1S/C11H21N5/c1-3-11(4-2)5-7-16(8-6-11)10-13-9(12)14-15-10/h3-8H2,1-2H3,(H3,12,13,14,15) |
| InChIKey | UDXAIYSDXJHDHQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |