About 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine
2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine (PubChem CID 66276842) has the molecular formula C12H22F3NO
and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine |
| PubChem CID | 66276842 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine |
| SMILES | CC1CCCCC1NCCOC(C)C(F)(F)F |
| InChI | InChI=1S/C12H22F3NO/c1-9-5-3-4-6-11(9)16-7-8-17-10(2)12(13,14)15/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | BKXSFQPZXSJOQR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine?
The IUPAC name of 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine (CID 66276842) is 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine.
What is the SMILES notation for 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine?
The canonical SMILES for 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine is CC1CCCCC1NCCOC(C)C(F)(F)F.
What is the InChIKey of 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine?
The InChIKey is BKXSFQPZXSJOQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NO/c1-9-5-3-4-6-11(9)16-7-8-17-10(2)12(13,14)15/h9-11,16H,3-8H2,1-2H3.
What are the key properties of 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine?
2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine has a molecular weight of 253.31 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[2-(1,1,1-trifluoropropan-2-yloxy)ethyl]cyclohexan-1-amine is sourced from PubChem (CID 66276842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).