C9H8N8OS — CID 66276857
1-(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)-1,2,4-triazole-3-carbothioamide (PubChem CID 66276857) has the molecular formula C9H8N8OS and a molecular weight of 276.29 g/mol. Its IUPAC name is 1-(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 66276857 |
| Molecular Formula | C9H8N8OS |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-(5-methyl-3-oxo-2H-[1,2,4]triazolo[4,3-c]pyrimidin-7-yl)-1,2,4-triazole-3-carbothioamide |
| SMILES | Cc1nc(-n2cnc(C(N)=S)n2)cc2n[nH]c(=O)n12 |
| InChI | InChI=1S/C9H8N8OS/c1-4-12-5(2-6-13-14-9(18)17(4)6)16-3-11-8(15-16)7(10)19/h2-3H,1H3,(H2,10,19)(H,14,18) |
| InChIKey | UMFJZIGCAMCFMY-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 119.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|