C12H13F3O4 — CID 66277064
2-methoxy-5-(1,1,1-trifluoropropan-2-yloxymethyl)benzoic acid (PubChem CID 66277064) has the molecular formula C12H13F3O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-methoxy-5-(1,1,1-trifluoropropan-2-yloxymethyl)benzoic acid.
| Compound Name | 2-methoxy-5-(1,1,1-trifluoropropan-2-yloxymethyl)benzoic acid |
|---|---|
| PubChem CID | 66277064 |
| Molecular Formula | C12H13F3O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-methoxy-5-(1,1,1-trifluoropropan-2-yloxymethyl)benzoic acid |
| SMILES | COc1ccc(COC(C)C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C12H13F3O4/c1-7(12(13,14)15)19-6-8-3-4-10(18-2)9(5-8)11(16)17/h3-5,7H,6H2,1-2H3,(H,16,17) |
| InChIKey | VBKJGNZGPOHCAH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |