About 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile
2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile (PubChem CID 66277224) has the molecular formula C10H17F3N2O
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile.
Molecular Properties
| Compound Name | 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile |
| PubChem CID | 66277224 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile |
| SMILES | CCCNC(C#N)CCOC(C)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O/c1-3-5-15-9(7-14)4-6-16-8(2)10(11,12)13/h8-9,15H,3-6H2,1-2H3 |
| InChIKey | FAQQCVWHQXIVPB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile?
The IUPAC name of 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile (CID 66277224) is 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile.
What is the SMILES notation for 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile?
The canonical SMILES for 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile is CCCNC(C#N)CCOC(C)C(F)(F)F.
What is the InChIKey of 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile?
The InChIKey is FAQQCVWHQXIVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O/c1-3-5-15-9(7-14)4-6-16-8(2)10(11,12)13/h8-9,15H,3-6H2,1-2H3.
What are the key properties of 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile?
2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile has a molecular weight of 238.25 g/mol, XLogP of 2.24, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(propylamino)-4-(1,1,1-trifluoropropan-2-yloxy)butanenitrile is sourced from PubChem (CID 66277224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).