About [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride
[1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride (PubChem CID 66277495) has the molecular formula C11H18ClF3O3S
and a molecular weight of 322.78 g/mol. Its IUPAC name is [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride.
Molecular Properties
| Compound Name | [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride |
| PubChem CID | 66277495 |
| Molecular Formula | C11H18ClF3O3S |
| Molecular Weight | 322.78 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride |
| SMILES | CC(OCC1(CS(=O)(=O)Cl)CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H18ClF3O3S/c1-9(11(13,14)15)18-7-10(8-19(12,16)17)5-3-2-4-6-10/h9H,2-8H2,1H3 |
| InChIKey | PGQXDVOMMFIYQK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.78 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride?
The IUPAC name of [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride (CID 66277495) is [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride.
What is the SMILES notation for [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride?
The canonical SMILES for [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride is CC(OCC1(CS(=O)(=O)Cl)CCCCC1)C(F)(F)F.
What is the InChIKey of [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride?
The InChIKey is PGQXDVOMMFIYQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClF3O3S/c1-9(11(13,14)15)18-7-10(8-19(12,16)17)5-3-2-4-6-10/h9H,2-8H2,1H3.
What are the key properties of [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride?
[1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride has a molecular weight of 322.78 g/mol, XLogP of 3.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,1,1-trifluoropropan-2-yloxymethyl)cyclohexyl]methanesulfonyl chloride is sourced from PubChem (CID 66277495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).