C9H12F3N3OS — CID 66277617
1,3-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazole-4-carbothioamide (PubChem CID 66277617) has the molecular formula C9H12F3N3OS and a molecular weight of 267.28 g/mol. Its IUPAC name is 1,3-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 66277617 |
| Molecular Formula | C9H12F3N3OS |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 1,3-dimethyl-5-(1,1,1-trifluoropropan-2-yloxy)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(OC(C)C(F)(F)F)c1C(N)=S |
| InChI | InChI=1S/C9H12F3N3OS/c1-4-6(7(13)17)8(15(3)14-4)16-5(2)9(10,11)12/h5H,1-3H3,(H2,13,17) |
| InChIKey | UAQVGENZIYXBHJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|