About 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine
4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine (PubChem CID 66277825) has the molecular formula C8H8ClF3N2O
and a molecular weight of 240.61 g/mol. Its IUPAC name is 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine |
| PubChem CID | 66277825 |
| Molecular Formula | C8H8ClF3N2O |
| Molecular Weight | 240.61 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine |
| SMILES | Cc1nc(Cl)cc(OC(C)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H8ClF3N2O/c1-4(8(10,11)12)15-7-3-6(9)13-5(2)14-7/h3-4H,1-2H3 |
| InChIKey | AAPPQUQYVZTATR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.61 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine?
The IUPAC name of 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine (CID 66277825) is 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine.
What is the SMILES notation for 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine?
The canonical SMILES for 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine is Cc1nc(Cl)cc(OC(C)C(F)(F)F)n1.
What is the InChIKey of 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine?
The InChIKey is AAPPQUQYVZTATR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClF3N2O/c1-4(8(10,11)12)15-7-3-6(9)13-5(2)14-7/h3-4H,1-2H3.
What are the key properties of 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine?
4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine has a molecular weight of 240.61 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-6-(1,1,1-trifluoropropan-2-yloxy)pyrimidine is sourced from PubChem (CID 66277825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).