C8H16N4S — CID 66277911
5-N-hexan-2-yl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 66277911) has the molecular formula C8H16N4S and a molecular weight of 200.31 g/mol. Its IUPAC name is 5-N-hexan-2-yl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-hexan-2-yl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 66277911 |
| Molecular Formula | C8H16N4S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 5-N-hexan-2-yl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCCCC(C)Nc1nc(N)ns1 |
| InChI | InChI=1S/C8H16N4S/c1-3-4-5-6(2)10-8-11-7(9)12-13-8/h6H,3-5H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | ZUMOIZGCEUPKDO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |